C18H25ClN2O5 — CID 97286367
3-chloro-4-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-N-(2-methoxyethyl)benzamide (PubChem CID 97286367) has the molecular formula C18H25ClN2O5 and a molecular weight of 384.86 g/mol. Its IUPAC name is 3-chloro-4-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-chloro-4-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 97286367 |
| Molecular Formula | C18H25ClN2O5 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 3-chloro-4-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]oxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(OC2CCN(C(=O)[C@H](C)O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H25ClN2O5/c1-12(22)18(24)21-8-5-14(6-9-21)26-16-4-3-13(11-15(16)19)17(23)20-7-10-25-2/h3-4,11-12,14,22H,5-10H2,1-2H3,(H,20,23)/t12-/m0/s1 |
| InChIKey | UTGBGSMAHOVQOO-LBPRGKRZSA-N |
| XLogP | 1.47 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|