C22H32ClN3O3 — CID 45243304
4-[1-(1-azabicyclo[2.2.2]octan-3-yl)piperidin-4-yl]oxy-3-chloro-N-(2-methoxyethyl)benzamide (PubChem CID 45243304) has the molecular formula C22H32ClN3O3 and a molecular weight of 421.97 g/mol. Its IUPAC name is 4-[1-(1-azabicyclo[2.2.2]octan-3-yl)piperidin-4-yl]oxy-3-chloro-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-[1-(1-azabicyclo[2.2.2]octan-3-yl)piperidin-4-yl]oxy-3-chloro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 45243304 |
| Molecular Formula | C22H32ClN3O3 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 4-[1-(1-azabicyclo[2.2.2]octan-3-yl)piperidin-4-yl]oxy-3-chloro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(OC2CCN(C3CN4CCC3CC4)CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H32ClN3O3/c1-28-13-8-24-22(27)17-2-3-21(19(23)14-17)29-18-6-11-26(12-7-18)20-15-25-9-4-16(20)5-10-25/h2-3,14,16,18,20H,4-13,15H2,1H3,(H,24,27) |
| InChIKey | YRSFFXZEZZIZFN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|