C21H27ClN4O3S — CID 42241824
3-chloro-N-(2-methoxyethyl)-4-[1-[(2-methylsulfanylpyrimidin-5-yl)methyl]piperidin-4-yl]oxybenzamide (PubChem CID 42241824) has the molecular formula C21H27ClN4O3S and a molecular weight of 450.99 g/mol. Its IUPAC name is 3-chloro-N-(2-methoxyethyl)-4-[1-[(2-methylsulfanylpyrimidin-5-yl)methyl]piperidin-4-yl]oxybenzamide.
| Compound Name | 3-chloro-N-(2-methoxyethyl)-4-[1-[(2-methylsulfanylpyrimidin-5-yl)methyl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 42241824 |
| Molecular Formula | C21H27ClN4O3S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 3-chloro-N-(2-methoxyethyl)-4-[1-[(2-methylsulfanylpyrimidin-5-yl)methyl]piperidin-4-yl]oxybenzamide |
| SMILES | COCCNC(=O)c1ccc(OC2CCN(Cc3cnc(SC)nc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C21H27ClN4O3S/c1-28-10-7-23-20(27)16-3-4-19(18(22)11-16)29-17-5-8-26(9-6-17)14-15-12-24-21(30-2)25-13-15/h3-4,11-13,17H,5-10,14H2,1-2H3,(H,23,27) |
| InChIKey | MFDAQYVVDVLXOB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|