C28H38ClN3O5 — CID 67390289
tert-butyl N-[3-[[3-chloro-4-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]oxybenzoyl]amino]propyl]carbamate (PubChem CID 67390289) has the molecular formula C28H38ClN3O5 and a molecular weight of 532.08 g/mol. Its IUPAC name is tert-butyl N-[3-[[3-chloro-4-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]oxybenzoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[3-chloro-4-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]oxybenzoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 67390289 |
| Molecular Formula | C28H38ClN3O5 |
| Molecular Weight | 532.08 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | tert-butyl N-[3-[[3-chloro-4-[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]oxybenzoyl]amino]propyl]carbamate |
| SMILES | COc1ccc(CN2CCC(Oc3ccc(C(=O)NCCCNC(=O)OC(C)(C)C)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C28H38ClN3O5/c1-28(2,3)37-27(34)31-15-5-14-30-26(33)21-8-11-25(24(29)18-21)36-23-12-16-32(17-13-23)19-20-6-9-22(35-4)10-7-20/h6-11,18,23H,5,12-17,19H2,1-4H3,(H,30,33)(H,31,34) |
| InChIKey | PATMLCOXFQWUIP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.08 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|