C20H29ClN2O4 — CID 42512436
3-chloro-N-(2-methoxyethyl)-4-[1-(oxan-4-yl)piperidin-4-yl]oxybenzamide (PubChem CID 42512436) has the molecular formula C20H29ClN2O4 and a molecular weight of 396.92 g/mol. Its IUPAC name is 3-chloro-N-(2-methoxyethyl)-4-[1-(oxan-4-yl)piperidin-4-yl]oxybenzamide.
| Compound Name | 3-chloro-N-(2-methoxyethyl)-4-[1-(oxan-4-yl)piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 42512436 |
| Molecular Formula | C20H29ClN2O4 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3-chloro-N-(2-methoxyethyl)-4-[1-(oxan-4-yl)piperidin-4-yl]oxybenzamide |
| SMILES | COCCNC(=O)c1ccc(OC2CCN(C3CCOCC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C20H29ClN2O4/c1-25-13-8-22-20(24)15-2-3-19(18(21)14-15)27-17-4-9-23(10-5-17)16-6-11-26-12-7-16/h2-3,14,16-17H,4-13H2,1H3,(H,22,24) |
| InChIKey | GVJMRMOJWCWNTC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|