C22H31ClN4O3 — CID 45242115
3-chloro-4-[1-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperidin-4-yl]oxy-N-(2-methoxyethyl)benzamide (PubChem CID 45242115) has the molecular formula C22H31ClN4O3 and a molecular weight of 434.97 g/mol. Its IUPAC name is 3-chloro-4-[1-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperidin-4-yl]oxy-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-chloro-4-[1-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperidin-4-yl]oxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 45242115 |
| Molecular Formula | C22H31ClN4O3 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 3-chloro-4-[1-[(2-ethyl-5-methyl-1H-imidazol-4-yl)methyl]piperidin-4-yl]oxy-N-(2-methoxyethyl)benzamide |
| SMILES | CCc1nc(CN2CCC(Oc3ccc(C(=O)NCCOC)cc3Cl)CC2)c(C)[nH]1 |
| InChI | InChI=1S/C22H31ClN4O3/c1-4-21-25-15(2)19(26-21)14-27-10-7-17(8-11-27)30-20-6-5-16(13-18(20)23)22(28)24-9-12-29-3/h5-6,13,17H,4,7-12,14H2,1-3H3,(H,24,28)(H,25,26) |
| InChIKey | CFJHVRPDWYLSEC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|