C23H30ClN3O3 — CID 25299524
3-chloro-N-(2-methoxyethyl)-4-[1-[(2R)-1-pyridin-2-ylpropan-2-yl]piperidin-4-yl]oxybenzamide (PubChem CID 25299524) has the molecular formula C23H30ClN3O3 and a molecular weight of 431.96 g/mol. Its IUPAC name is 3-chloro-N-(2-methoxyethyl)-4-[1-[(2R)-1-pyridin-2-ylpropan-2-yl]piperidin-4-yl]oxybenzamide.
| Compound Name | 3-chloro-N-(2-methoxyethyl)-4-[1-[(2R)-1-pyridin-2-ylpropan-2-yl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 25299524 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 3-chloro-N-(2-methoxyethyl)-4-[1-[(2R)-1-pyridin-2-ylpropan-2-yl]piperidin-4-yl]oxybenzamide |
| SMILES | COCCNC(=O)c1ccc(OC2CCN([C@H](C)Cc3ccccn3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C23H30ClN3O3/c1-17(15-19-5-3-4-10-25-19)27-12-8-20(9-13-27)30-22-7-6-18(16-21(22)24)23(28)26-11-14-29-2/h3-7,10,16-17,20H,8-9,11-15H2,1-2H3,(H,26,28)/t17-/m1/s1 |
| InChIKey | NBABHWNZYWOCJX-QGZVFWFLSA-N |
| XLogP | 3.59 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|