C25H32ClN3O2 — CID 42198239
3-chloro-N-cyclopentyl-4-[1-[(2R)-1-pyridin-3-ylpropan-2-yl]piperidin-4-yl]oxybenzamide (PubChem CID 42198239) has the molecular formula C25H32ClN3O2 and a molecular weight of 442.00 g/mol. Its IUPAC name is 3-chloro-N-cyclopentyl-4-[1-[(2R)-1-pyridin-3-ylpropan-2-yl]piperidin-4-yl]oxybenzamide.
| Compound Name | 3-chloro-N-cyclopentyl-4-[1-[(2R)-1-pyridin-3-ylpropan-2-yl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 42198239 |
| Molecular Formula | C25H32ClN3O2 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 3-chloro-N-cyclopentyl-4-[1-[(2R)-1-pyridin-3-ylpropan-2-yl]piperidin-4-yl]oxybenzamide |
| SMILES | C[C@H](Cc1cccnc1)N1CCC(Oc2ccc(C(=O)NC3CCCC3)cc2Cl)CC1 |
| InChI | InChI=1S/C25H32ClN3O2/c1-18(15-19-5-4-12-27-17-19)29-13-10-22(11-14-29)31-24-9-8-20(16-23(24)26)25(30)28-21-6-2-3-7-21/h4-5,8-9,12,16-18,21-22H,2-3,6-7,10-11,13-15H2,1H3,(H,28,30)/t18-/m1/s1 |
| InChIKey | UYVPZNWTKYYVDR-GOSISDBHSA-N |
| XLogP | 4.88 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |