C22H33ClN2O2S — CID 42114628
3-chloro-N-cyclopentyl-4-[1-[(2S)-4-methylsulfanylbutan-2-yl]piperidin-4-yl]oxybenzamide (PubChem CID 42114628) has the molecular formula C22H33ClN2O2S and a molecular weight of 425.04 g/mol. Its IUPAC name is 3-chloro-N-cyclopentyl-4-[1-[(2S)-4-methylsulfanylbutan-2-yl]piperidin-4-yl]oxybenzamide.
| Compound Name | 3-chloro-N-cyclopentyl-4-[1-[(2S)-4-methylsulfanylbutan-2-yl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 42114628 |
| Molecular Formula | C22H33ClN2O2S |
| Molecular Weight | 425.04 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 3-chloro-N-cyclopentyl-4-[1-[(2S)-4-methylsulfanylbutan-2-yl]piperidin-4-yl]oxybenzamide |
| SMILES | CSCC[C@H](C)N1CCC(Oc2ccc(C(=O)NC3CCCC3)cc2Cl)CC1 |
| InChI | InChI=1S/C22H33ClN2O2S/c1-16(11-14-28-2)25-12-9-19(10-13-25)27-21-8-7-17(15-20(21)23)22(26)24-18-5-3-4-6-18/h7-8,15-16,18-19H,3-6,9-14H2,1-2H3,(H,24,26)/t16-/m0/s1 |
| InChIKey | FRXYJVOXSDWSCD-INIZCTEOSA-N |
| XLogP | 5.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.04 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |