C23H25ClN2O5 — CID 42453495
3-chloro-N-cyclopentyl-4-[1-[2-(furan-2-yl)-2-oxoacetyl]piperidin-4-yl]oxybenzamide (PubChem CID 42453495) has the molecular formula C23H25ClN2O5 and a molecular weight of 444.92 g/mol. Its IUPAC name is 3-chloro-N-cyclopentyl-4-[1-[2-(furan-2-yl)-2-oxoacetyl]piperidin-4-yl]oxybenzamide.
| Compound Name | 3-chloro-N-cyclopentyl-4-[1-[2-(furan-2-yl)-2-oxoacetyl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 42453495 |
| Molecular Formula | C23H25ClN2O5 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 3-chloro-N-cyclopentyl-4-[1-[2-(furan-2-yl)-2-oxoacetyl]piperidin-4-yl]oxybenzamide |
| SMILES | O=C(NC1CCCC1)c1ccc(OC2CCN(C(=O)C(=O)c3ccco3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C23H25ClN2O5/c24-18-14-15(22(28)25-16-4-1-2-5-16)7-8-19(18)31-17-9-11-26(12-10-17)23(29)21(27)20-6-3-13-30-20/h3,6-8,13-14,16-17H,1-2,4-5,9-12H2,(H,25,28) |
| InChIKey | BNOAPAYDDDOTRO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|