C30H37F3N2O2 — CID 158533222
N-[(2S)-7-[(1R,2R)-2-(4-methylphenyl)cyclopropyl]-1-oxo-1-piperidin-1-ylheptan-2-yl]-4-(trifluoromethyl)benzamide (PubChem CID 158533222) has the molecular formula C30H37F3N2O2 and a molecular weight of 514.63 g/mol. Its IUPAC name is N-[(2S)-7-[(1R,2R)-2-(4-methylphenyl)cyclopropyl]-1-oxo-1-piperidin-1-ylheptan-2-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-7-[(1R,2R)-2-(4-methylphenyl)cyclopropyl]-1-oxo-1-piperidin-1-ylheptan-2-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 158533222 |
| Molecular Formula | C30H37F3N2O2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | N-[(2S)-7-[(1R,2R)-2-(4-methylphenyl)cyclopropyl]-1-oxo-1-piperidin-1-ylheptan-2-yl]-4-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc([C@@H]2C[C@H]2CCCCC[C@H](NC(=O)c2ccc(C(F)(F)F)cc2)C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C30H37F3N2O2/c1-21-10-12-22(13-11-21)26-20-24(26)8-4-2-5-9-27(29(37)35-18-6-3-7-19-35)34-28(36)23-14-16-25(17-15-23)30(31,32)33/h10-17,24,26-27H,2-9,18-20H2,1H3,(H,34,36)/t24-,26+,27+/m1/s1 |
| InChIKey | IOMLECLKOOQAJO-STXQHDJLSA-N |
| XLogP | 6.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|