C25H24N2O5 — CID 68700542
(4S)-5-(benzylamino)-4-[[4-(4-hydroxyphenyl)benzoyl]amino]-5-oxopentanoic acid (PubChem CID 68700542) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is (4S)-5-(benzylamino)-4-[[4-(4-hydroxyphenyl)benzoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-(benzylamino)-4-[[4-(4-hydroxyphenyl)benzoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 68700542 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (4S)-5-(benzylamino)-4-[[4-(4-hydroxyphenyl)benzoyl]amino]-5-oxopentanoic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1ccc(-c2ccc(O)cc2)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H24N2O5/c28-21-12-10-19(11-13-21)18-6-8-20(9-7-18)24(31)27-22(14-15-23(29)30)25(32)26-16-17-4-2-1-3-5-17/h1-13,22,28H,14-16H2,(H,26,32)(H,27,31)(H,29,30)/t22-/m0/s1 |
| InChIKey | RYYPHTADGHSXMV-QFIPXVFZSA-N |
| XLogP | 3.34 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |