C19H19BrN2O3 — CID 88910399
N-[(2S)-1-(benzylamino)-1,5-dioxopentan-2-yl]-4-bromobenzamide (PubChem CID 88910399) has the molecular formula C19H19BrN2O3 and a molecular weight of 403.28 g/mol. Its IUPAC name is N-[(2S)-1-(benzylamino)-1,5-dioxopentan-2-yl]-4-bromobenzamide.
| Compound Name | N-[(2S)-1-(benzylamino)-1,5-dioxopentan-2-yl]-4-bromobenzamide |
|---|---|
| PubChem CID | 88910399 |
| Molecular Formula | C19H19BrN2O3 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N-[(2S)-1-(benzylamino)-1,5-dioxopentan-2-yl]-4-bromobenzamide |
| SMILES | O=CCC[C@H](NC(=O)c1ccc(Br)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H19BrN2O3/c20-16-10-8-15(9-11-16)18(24)22-17(7-4-12-23)19(25)21-13-14-5-2-1-3-6-14/h1-3,5-6,8-12,17H,4,7,13H2,(H,21,25)(H,22,24)/t17-/m0/s1 |
| InChIKey | MUDPVYIDNIDBJC-KRWDZBQOSA-N |
| XLogP | 2.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|