C31H31N2O5PS — CID 10393330
N-[(2S)-1-(benzylamino)-3-bis(phenylmethoxy)phosphinothioyloxy-1-oxopropan-2-yl]benzamide (PubChem CID 10393330) has the molecular formula C31H31N2O5PS and a molecular weight of 574.64 g/mol. Its IUPAC name is N-[(2S)-1-(benzylamino)-3-bis(phenylmethoxy)phosphinothioyloxy-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-(benzylamino)-3-bis(phenylmethoxy)phosphinothioyloxy-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 10393330 |
| Molecular Formula | C31H31N2O5PS |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | N-[(2S)-1-(benzylamino)-3-bis(phenylmethoxy)phosphinothioyloxy-1-oxopropan-2-yl]benzamide |
| SMILES | O=C(N[C@@H](COP(=S)(OCc1ccccc1)OCc1ccccc1)C(=O)NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H31N2O5PS/c34-30(28-19-11-4-12-20-28)33-29(31(35)32-21-25-13-5-1-6-14-25)24-38-39(40,36-22-26-15-7-2-8-16-26)37-23-27-17-9-3-10-18-27/h1-20,29H,21-24H2,(H,32,35)(H,33,34)/t29-/m0/s1 |
| InChIKey | IOQGKNXZFWSAAD-LJAQVGFWSA-N |
| XLogP | 5.78 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|