C30H35N5O4 — CID 54293234
methyl N-[N'-[4-[(2,2-diphenylacetyl)amino]-5-[(4-methylphenyl)methylamino]-5-oxopentyl]carbamimidoyl]carbamate (PubChem CID 54293234) has the molecular formula C30H35N5O4 and a molecular weight of 529.64 g/mol. Its IUPAC name is methyl N-[N'-[4-[(2,2-diphenylacetyl)amino]-5-[(4-methylphenyl)methylamino]-5-oxopentyl]carbamimidoyl]carbamate.
| Compound Name | methyl N-[N'-[4-[(2,2-diphenylacetyl)amino]-5-[(4-methylphenyl)methylamino]-5-oxopentyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 54293234 |
| Molecular Formula | C30H35N5O4 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | methyl N-[N'-[4-[(2,2-diphenylacetyl)amino]-5-[(4-methylphenyl)methylamino]-5-oxopentyl]carbamimidoyl]carbamate |
| SMILES | COC(=O)N/C(N)=N/CCCC(NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C30H35N5O4/c1-21-15-17-22(18-16-21)20-33-27(36)25(14-9-19-32-29(31)35-30(38)39-2)34-28(37)26(23-10-5-3-6-11-23)24-12-7-4-8-13-24/h3-8,10-13,15-18,25-26H,9,14,19-20H2,1-2H3,(H,33,36)(H,34,37)(H3,31,32,35,38) |
| InChIKey | RYZOJUIBLADHDF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|