C24H27ClN6O2 — CID 134580870
N-[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-2-ethyl-3-oxo-1H-isoindole-4-carboxamide (PubChem CID 134580870) has the molecular formula C24H27ClN6O2 and a molecular weight of 466.97 g/mol. Its IUPAC name is N-[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-2-ethyl-3-oxo-1H-isoindole-4-carboxamide.
| Compound Name | N-[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-2-ethyl-3-oxo-1H-isoindole-4-carboxamide |
|---|---|
| PubChem CID | 134580870 |
| Molecular Formula | C24H27ClN6O2 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-2-ethyl-3-oxo-1H-isoindole-4-carboxamide |
| SMILES | CCN1Cc2cccc(C(=O)NC(CCC/N=C(/N)CCl)c3nc4ccccc4[nH]3)c2C1=O |
| InChI | InChI=1S/C24H27ClN6O2/c1-2-31-14-15-7-5-8-16(21(15)24(31)33)23(32)30-19(11-6-12-27-20(26)13-25)22-28-17-9-3-4-10-18(17)29-22/h3-5,7-10,19H,2,6,11-14H2,1H3,(H2,26,27)(H,28,29)(H,30,32) |
| InChIKey | SERABSVELSOHHG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|