C28H31ClN8O — CID 176698873
N-[(1S)-4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide (PubChem CID 176698873) has the molecular formula C28H31ClN8O and a molecular weight of 531.06 g/mol. Its IUPAC name is N-[(1S)-4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide.
| Compound Name | N-[(1S)-4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide |
|---|---|
| PubChem CID | 176698873 |
| Molecular Formula | C28H31ClN8O |
| Molecular Weight | 531.06 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | N-[(1S)-4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-4-[[4-(dimethylamino)phenyl]diazenyl]benzamide |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(C(=O)N[C@@H](CCC/N=C(/N)CCl)c3nc4ccccc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C28H31ClN8O/c1-37(2)22-15-13-21(14-16-22)36-35-20-11-9-19(10-12-20)28(38)34-25(8-5-17-31-26(30)18-29)27-32-23-6-3-4-7-24(23)33-27/h3-4,6-7,9-16,25H,5,8,17-18H2,1-2H3,(H2,30,31)(H,32,33)(H,34,38)/b36-35+/t25-/m0/s1 |
| InChIKey | NPDYUIJKRZPUKR-STFNVURLSA-N |
| XLogP | 5.89 |
| TPSA | 124.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.06 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|