C25H34ClN5O2 — CID 176698845
N-[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-2-methoxy-3,5-dimethylbenzamide;ethane (PubChem CID 176698845) has the molecular formula C25H34ClN5O2 and a molecular weight of 472.03 g/mol. Its IUPAC name is N-[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-2-methoxy-3,5-dimethylbenzamide;ethane.
| Compound Name | N-[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-2-methoxy-3,5-dimethylbenzamide;ethane |
|---|---|
| PubChem CID | 176698845 |
| Molecular Formula | C25H34ClN5O2 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N-[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-2-methoxy-3,5-dimethylbenzamide;ethane |
| SMILES | CC.COc1c(C)cc(C)cc1C(=O)NC(CCC/N=C(/N)CCl)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H28ClN5O2.C2H6/c1-14-11-15(2)21(31-3)16(12-14)23(30)29-19(9-6-10-26-20(25)13-24)22-27-17-7-4-5-8-18(17)28-22;1-2/h4-5,7-8,11-12,19H,6,9-10,13H2,1-3H3,(H2,25,26)(H,27,28)(H,29,30);1-2H3 |
| InChIKey | OPVVFNRTEOKZBU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|