C29H28ClN5O — CID 176698865
N-[(1S)-4-[(1-amino-2-chloropropylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-4-(4-ethynylphenyl)benzamide (PubChem CID 176698865) has the molecular formula C29H28ClN5O and a molecular weight of 498.03 g/mol. Its IUPAC name is N-[(1S)-4-[(1-amino-2-chloropropylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-4-(4-ethynylphenyl)benzamide.
| Compound Name | N-[(1S)-4-[(1-amino-2-chloropropylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-4-(4-ethynylphenyl)benzamide |
|---|---|
| PubChem CID | 176698865 |
| Molecular Formula | C29H28ClN5O |
| Molecular Weight | 498.03 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | N-[(1S)-4-[(1-amino-2-chloropropylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]-4-(4-ethynylphenyl)benzamide |
| SMILES | C#Cc1ccc(-c2ccc(C(=O)N[C@@H](CCC/N=C(/N)C(C)Cl)c3nc4ccccc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C29H28ClN5O/c1-3-20-10-12-21(13-11-20)22-14-16-23(17-15-22)29(36)35-26(9-6-18-32-27(31)19(2)30)28-33-24-7-4-5-8-25(24)34-28/h1,4-5,7-8,10-17,19,26H,6,9,18H2,2H3,(H2,31,32)(H,33,34)(H,35,36)/t19?,26-/m0/s1 |
| InChIKey | QUHLZFGVCYSFAB-SYCQMTRVSA-N |
| XLogP | 5.45 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.03 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|