C26H30ClN7O2 — CID 176698834
4-amino-N-[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]benzamide;4-aminophenol (PubChem CID 176698834) has the molecular formula C26H30ClN7O2 and a molecular weight of 508.03 g/mol. Its IUPAC name is 4-amino-N-[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]benzamide;4-aminophenol.
| Compound Name | 4-amino-N-[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]benzamide;4-aminophenol |
|---|---|
| PubChem CID | 176698834 |
| Molecular Formula | C26H30ClN7O2 |
| Molecular Weight | 508.03 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 4-amino-N-[4-[(1-amino-2-chloroethylidene)amino]-1-(1H-benzimidazol-2-yl)butyl]benzamide;4-aminophenol |
| SMILES | N/C(CCl)=N/CCCC(NC(=O)c1ccc(N)cc1)c1nc2ccccc2[nH]1.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C20H23ClN6O.C6H7NO/c21-12-18(23)24-11-3-6-17(19-25-15-4-1-2-5-16(15)26-19)27-20(28)13-7-9-14(22)10-8-13;7-5-1-3-6(8)4-2-5/h1-2,4-5,7-10,17H,3,6,11-12,22H2,(H2,23,24)(H,25,26)(H,27,28);1-4,8H,7H2 |
| InChIKey | KATOIWOQADBDRQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 168.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.03 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|