C23H25ClN6O2 — CID 134580844
N-[(1S)-4-[(1-amino-2-chloroethylidene)amino]-1-(1-methylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide (PubChem CID 134580844) has the molecular formula C23H25ClN6O2 and a molecular weight of 452.95 g/mol. Its IUPAC name is N-[(1S)-4-[(1-amino-2-chloroethylidene)amino]-1-(1-methylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide.
| Compound Name | N-[(1S)-4-[(1-amino-2-chloroethylidene)amino]-1-(1-methylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide |
|---|---|
| PubChem CID | 134580844 |
| Molecular Formula | C23H25ClN6O2 |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-[(1S)-4-[(1-amino-2-chloroethylidene)amino]-1-(1-methylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide |
| SMILES | Cn1c([C@H](CCC/N=C(/N)CCl)NC(=O)c2cccc3c2C(=O)NC3)nc2ccccc21 |
| InChI | InChI=1S/C23H25ClN6O2/c1-30-18-10-3-2-8-16(18)28-21(30)17(9-5-11-26-19(25)12-24)29-22(31)15-7-4-6-14-13-27-23(32)20(14)15/h2-4,6-8,10,17H,5,9,11-13H2,1H3,(H2,25,26)(H,27,32)(H,29,31)/t17-/m0/s1 |
| InChIKey | NQSUJHYBKHMVBF-KRWDZBQOSA-N |
| XLogP | 2.66 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|