C25H29FN6O2 — CID 134580696
N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(1-propan-2-ylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide (PubChem CID 134580696) has the molecular formula C25H29FN6O2 and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(1-propan-2-ylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide.
| Compound Name | N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(1-propan-2-ylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide |
|---|---|
| PubChem CID | 134580696 |
| Molecular Formula | C25H29FN6O2 |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | N-[(1S)-4-[(1-amino-2-fluoroethylidene)amino]-1-(1-propan-2-ylbenzimidazol-2-yl)butyl]-3-oxo-1,2-dihydroisoindole-4-carboxamide |
| SMILES | CC(C)n1c([C@H](CCC/N=C(/N)CF)NC(=O)c2cccc3c2C(=O)NC3)nc2ccccc21 |
| InChI | InChI=1S/C25H29FN6O2/c1-15(2)32-20-11-4-3-9-18(20)30-23(32)19(10-6-12-28-21(27)13-26)31-24(33)17-8-5-7-16-14-29-25(34)22(16)17/h3-5,7-9,11,15,19H,6,10,12-14H2,1-2H3,(H2,27,28)(H,29,34)(H,31,33)/t19-/m0/s1 |
| InChIKey | PSMSUTKSNJQJIT-IBGZPJMESA-N |
| XLogP | 3.44 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|