C21H25ClN2O2S — CID 100654806
ethyl 2-chloro-5-[[(1R)-3-methyl-1-phenylbutyl]carbamothioylamino]benzoate (PubChem CID 100654806) has the molecular formula C21H25ClN2O2S and a molecular weight of 404.96 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[(1R)-3-methyl-1-phenylbutyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[(1R)-3-methyl-1-phenylbutyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100654806 |
| Molecular Formula | C21H25ClN2O2S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | ethyl 2-chloro-5-[[(1R)-3-methyl-1-phenylbutyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=S)N[C@H](CC(C)C)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C21H25ClN2O2S/c1-4-26-20(25)17-13-16(10-11-18(17)22)23-21(27)24-19(12-14(2)3)15-8-6-5-7-9-15/h5-11,13-14,19H,4,12H2,1-3H3,(H2,23,24,27)/t19-/m1/s1 |
| InChIKey | VQZMFORFRYESHS-LJQANCHMSA-N |
| XLogP | 5.59 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|