C21H22Cl2N2O5S — CID 133189497
ethyl 2-chloro-5-[[1-(4-chlorophenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate (PubChem CID 133189497) has the molecular formula C21H22Cl2N2O5S and a molecular weight of 485.39 g/mol. Its IUPAC name is ethyl 2-chloro-5-[[1-(4-chlorophenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-chloro-5-[[1-(4-chlorophenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 133189497 |
| Molecular Formula | C21H22Cl2N2O5S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | ethyl 2-chloro-5-[[1-(4-chlorophenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)C2CCCN(S(=O)(=O)c3ccc(Cl)cc3)C2)ccc1Cl |
| InChI | InChI=1S/C21H22Cl2N2O5S/c1-2-30-21(27)18-12-16(7-10-19(18)23)24-20(26)14-4-3-11-25(13-14)31(28,29)17-8-5-15(22)6-9-17/h5-10,12,14H,2-4,11,13H2,1H3,(H,24,26) |
| InChIKey | WXDNEXUKQLUJGS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |