C22H25ClN2O6S — CID 41302723
ethyl 4-[[(3R)-1-(3-chloro-4-methoxyphenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate (PubChem CID 41302723) has the molecular formula C22H25ClN2O6S and a molecular weight of 480.97 g/mol. Its IUPAC name is ethyl 4-[[(3R)-1-(3-chloro-4-methoxyphenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[(3R)-1-(3-chloro-4-methoxyphenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 41302723 |
| Molecular Formula | C22H25ClN2O6S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | ethyl 4-[[(3R)-1-(3-chloro-4-methoxyphenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@@H]2CCCN(S(=O)(=O)c3ccc(OC)c(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C22H25ClN2O6S/c1-3-31-22(27)15-6-8-17(9-7-15)24-21(26)16-5-4-12-25(14-16)32(28,29)18-10-11-20(30-2)19(23)13-18/h6-11,13,16H,3-5,12,14H2,1-2H3,(H,24,26)/t16-/m1/s1 |
| InChIKey | HPZHCHIBIQWCRT-MRXNPFEDSA-N |
| XLogP | 3.56 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |