C26H33N3O4 — CID 163965159
3-ethoxypropyl 5-[[(2S,3S)-3-cyclohexa-2,4-dien-1-ylpyrrolidine-2-carbonyl]amino]-1-methylindole-2-carboxylate (PubChem CID 163965159) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-ethoxypropyl 5-[[(2S,3S)-3-cyclohexa-2,4-dien-1-ylpyrrolidine-2-carbonyl]amino]-1-methylindole-2-carboxylate.
| Compound Name | 3-ethoxypropyl 5-[[(2S,3S)-3-cyclohexa-2,4-dien-1-ylpyrrolidine-2-carbonyl]amino]-1-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 163965159 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 3-ethoxypropyl 5-[[(2S,3S)-3-cyclohexa-2,4-dien-1-ylpyrrolidine-2-carbonyl]amino]-1-methylindole-2-carboxylate |
| SMILES | CCOCCCOC(=O)c1cc2cc(NC(=O)[C@H]3NCC[C@H]3C3C=CC=CC3)ccc2n1C |
| InChI | InChI=1S/C26H33N3O4/c1-3-32-14-7-15-33-26(31)23-17-19-16-20(10-11-22(19)29(23)2)28-25(30)24-21(12-13-27-24)18-8-5-4-6-9-18/h4-6,8,10-11,16-18,21,24,27H,3,7,9,12-15H2,1-2H3,(H,28,30)/t18?,21-,24-/m0/s1 |
| InChIKey | SLAYLCRZDALHND-ZCAYSAGXSA-N |
| XLogP | 3.81 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|