C35H38N4O6 — CID 161003594
ethyl 5-amino-1-methylindole-2-carboxylate;ethyl 5-[[4-(cyclopropylmethoxy)benzoyl]amino]-1-methylindole-2-carboxylate (PubChem CID 161003594) has the molecular formula C35H38N4O6 and a molecular weight of 610.71 g/mol. Its IUPAC name is ethyl 5-amino-1-methylindole-2-carboxylate;ethyl 5-[[4-(cyclopropylmethoxy)benzoyl]amino]-1-methylindole-2-carboxylate.
| Compound Name | ethyl 5-amino-1-methylindole-2-carboxylate;ethyl 5-[[4-(cyclopropylmethoxy)benzoyl]amino]-1-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 161003594 |
| Molecular Formula | C35H38N4O6 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | ethyl 5-amino-1-methylindole-2-carboxylate;ethyl 5-[[4-(cyclopropylmethoxy)benzoyl]amino]-1-methylindole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(N)ccc2n1C.CCOC(=O)c1cc2cc(NC(=O)c3ccc(OCC4CC4)cc3)ccc2n1C |
| InChI | InChI=1S/C23H24N2O4.C12H14N2O2/c1-3-28-23(27)21-13-17-12-18(8-11-20(17)25(21)2)24-22(26)16-6-9-19(10-7-16)29-14-15-4-5-15;1-3-16-12(15)11-7-8-6-9(13)4-5-10(8)14(11)2/h6-13,15H,3-5,14H2,1-2H3,(H,24,26);4-7H,3,13H2,1-2H3 |
| InChIKey | TWFBEWZJMCJLDA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|