C34H36N2O7 — CID 161058773
4-(cyclopropylmethoxy)benzoic acid;methyl 5-[[4-(cyclopropylmethoxy)benzoyl]amino]-1,3-dimethylindole-2-carboxylate (PubChem CID 161058773) has the molecular formula C34H36N2O7 and a molecular weight of 584.67 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)benzoic acid;methyl 5-[[4-(cyclopropylmethoxy)benzoyl]amino]-1,3-dimethylindole-2-carboxylate.
| Compound Name | 4-(cyclopropylmethoxy)benzoic acid;methyl 5-[[4-(cyclopropylmethoxy)benzoyl]amino]-1,3-dimethylindole-2-carboxylate |
|---|---|
| PubChem CID | 161058773 |
| Molecular Formula | C34H36N2O7 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | 4-(cyclopropylmethoxy)benzoic acid;methyl 5-[[4-(cyclopropylmethoxy)benzoyl]amino]-1,3-dimethylindole-2-carboxylate |
| SMILES | COC(=O)c1c(C)c2cc(NC(=O)c3ccc(OCC4CC4)cc3)ccc2n1C.O=C(O)c1ccc(OCC2CC2)cc1 |
| InChI | InChI=1S/C23H24N2O4.C11H12O3/c1-14-19-12-17(8-11-20(19)25(2)21(14)23(27)28-3)24-22(26)16-6-9-18(10-7-16)29-13-15-4-5-15;12-11(13)9-3-5-10(6-4-9)14-7-8-1-2-8/h6-12,15H,4-5,13H2,1-3H3,(H,24,26);3-6,8H,1-2,7H2,(H,12,13) |
| InChIKey | UDCOPGDVDOWQGH-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|