C27H35N3O4 — CID 70967935
N-[2-[[(2-hydroxy-2-methylpropyl)amino]methyl]-1,3-dimethylindol-5-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide (PubChem CID 70967935) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is N-[2-[[(2-hydroxy-2-methylpropyl)amino]methyl]-1,3-dimethylindol-5-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide.
| Compound Name | N-[2-[[(2-hydroxy-2-methylpropyl)amino]methyl]-1,3-dimethylindol-5-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 70967935 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | N-[2-[[(2-hydroxy-2-methylpropyl)amino]methyl]-1,3-dimethylindol-5-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
| SMILES | Cc1c(CNCC(C)(C)O)n(C)c2ccc(NC(=O)c3ccc(OC[C@@H]4CCCO4)cc3)cc12 |
| InChI | InChI=1S/C27H35N3O4/c1-18-23-14-20(9-12-24(23)30(4)25(18)15-28-17-27(2,3)32)29-26(31)19-7-10-21(11-8-19)34-16-22-6-5-13-33-22/h7-12,14,22,28,32H,5-6,13,15-17H2,1-4H3,(H,29,31)/t22-/m0/s1 |
| InChIKey | NRQSMRDEKCUQFZ-QFIPXVFZSA-N |
| XLogP | 4.16 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|