C28H35N3O4 — CID 70967902
N-[3-methyl-2-[(oxan-4-ylmethylamino)methyl]-1H-indol-5-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide (PubChem CID 70967902) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[3-methyl-2-[(oxan-4-ylmethylamino)methyl]-1H-indol-5-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide.
| Compound Name | N-[3-methyl-2-[(oxan-4-ylmethylamino)methyl]-1H-indol-5-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 70967902 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-[3-methyl-2-[(oxan-4-ylmethylamino)methyl]-1H-indol-5-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
| SMILES | Cc1c(CNCC2CCOCC2)[nH]c2ccc(NC(=O)c3ccc(OC[C@@H]4CCCO4)cc3)cc12 |
| InChI | InChI=1S/C28H35N3O4/c1-19-25-15-22(6-9-26(25)31-27(19)17-29-16-20-10-13-33-14-11-20)30-28(32)21-4-7-23(8-5-21)35-18-24-3-2-12-34-24/h4-9,15,20,24,29,31H,2-3,10-14,16-18H2,1H3,(H,30,32)/t24-/m0/s1 |
| InChIKey | WUTSOEAOSYPFRY-DEOSSOPVSA-N |
| XLogP | 4.80 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|