C28H37N3O3 — CID 70968050
N-[2-[(2,2-dimethylpropylamino)methyl]-3,7-dimethyl-1H-indol-6-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide (PubChem CID 70968050) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-[2-[(2,2-dimethylpropylamino)methyl]-3,7-dimethyl-1H-indol-6-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide.
| Compound Name | N-[2-[(2,2-dimethylpropylamino)methyl]-3,7-dimethyl-1H-indol-6-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 70968050 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[2-[(2,2-dimethylpropylamino)methyl]-3,7-dimethyl-1H-indol-6-yl]-4-[[(2S)-oxolan-2-yl]methoxy]benzamide |
| SMILES | Cc1c(CNCC(C)(C)C)[nH]c2c(C)c(NC(=O)c3ccc(OC[C@@H]4CCCO4)cc3)ccc12 |
| InChI | InChI=1S/C28H37N3O3/c1-18-23-12-13-24(19(2)26(23)30-25(18)15-29-17-28(3,4)5)31-27(32)20-8-10-21(11-9-20)34-16-22-7-6-14-33-22/h8-13,22,29-30H,6-7,14-17H2,1-5H3,(H,31,32)/t22-/m0/s1 |
| InChIKey | DJFFCWYWQHNTRT-QFIPXVFZSA-N |
| XLogP | 5.73 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|