C24H26N2O5 — CID 70968014
methyl 1,3-dimethyl-5-[[4-[[(2S)-oxolan-2-yl]methoxy]benzoyl]amino]indole-2-carboxylate (PubChem CID 70968014) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is methyl 1,3-dimethyl-5-[[4-[[(2S)-oxolan-2-yl]methoxy]benzoyl]amino]indole-2-carboxylate.
| Compound Name | methyl 1,3-dimethyl-5-[[4-[[(2S)-oxolan-2-yl]methoxy]benzoyl]amino]indole-2-carboxylate |
|---|---|
| PubChem CID | 70968014 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | methyl 1,3-dimethyl-5-[[4-[[(2S)-oxolan-2-yl]methoxy]benzoyl]amino]indole-2-carboxylate |
| SMILES | COC(=O)c1c(C)c2cc(NC(=O)c3ccc(OC[C@@H]4CCCO4)cc3)ccc2n1C |
| InChI | InChI=1S/C24H26N2O5/c1-15-20-13-17(8-11-21(20)26(2)22(15)24(28)29-3)25-23(27)16-6-9-18(10-7-16)31-14-19-5-4-12-30-19/h6-11,13,19H,4-5,12,14H2,1-3H3,(H,25,27)/t19-/m0/s1 |
| InChIKey | VWIXYDKWVRQPHY-IBGZPJMESA-N |
| XLogP | 4.08 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|