C26H36N2O6 — CID 118089212
3-(2-methoxyethoxy)propyl 5-[[(2S,3S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-1-benzofuran-2-carboxylate (PubChem CID 118089212) has the molecular formula C26H36N2O6 and a molecular weight of 472.58 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)propyl 5-[[(2S,3S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-1-benzofuran-2-carboxylate.
| Compound Name | 3-(2-methoxyethoxy)propyl 5-[[(2S,3S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 118089212 |
| Molecular Formula | C26H36N2O6 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 3-(2-methoxyethoxy)propyl 5-[[(2S,3S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-1-benzofuran-2-carboxylate |
| SMILES | COCCOCCCOC(=O)c1cc2cc(NC(=O)[C@H]3NCC[C@H]3C3CCCCC3)ccc2o1 |
| InChI | InChI=1S/C26H36N2O6/c1-31-14-15-32-12-5-13-33-26(30)23-17-19-16-20(8-9-22(19)34-23)28-25(29)24-21(10-11-27-24)18-6-3-2-4-7-18/h8-9,16-18,21,24,27H,2-7,10-15H2,1H3,(H,28,29)/t21-,24-/m0/s1 |
| InChIKey | DILCJQYFOYVFAR-URXFXBBRSA-N |
| XLogP | 4.14 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|