C22H29N3O3 — CID 126493458
ethyl 5-[[(2S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-1H-indole-2-carboxylate (PubChem CID 126493458) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl 5-[[(2S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-[[(2S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 126493458 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | ethyl 5-[[(2S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(=O)[C@H]3NCCC3C3CCCCC3)ccc2[nH]1 |
| InChI | InChI=1S/C22H29N3O3/c1-2-28-22(27)19-13-15-12-16(8-9-18(15)25-19)24-21(26)20-17(10-11-23-20)14-6-4-3-5-7-14/h8-9,12-14,17,20,23,25H,2-7,10-11H2,1H3,(H,24,26)/t17?,20-/m0/s1 |
| InChIKey | BOMMSCNRUYYZLP-OZBJMMHXSA-N |
| XLogP | 3.84 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |