C22H28N2O4 — CID 130409953
ethyl 5-[[(2S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-1-benzofuran-2-carboxylate (PubChem CID 130409953) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is ethyl 5-[[(2S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[[(2S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 130409953 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | ethyl 5-[[(2S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(=O)[C@H]3NCCC3C3CCCCC3)ccc2o1 |
| InChI | InChI=1S/C22H28N2O4/c1-2-27-22(26)19-13-15-12-16(8-9-18(15)28-19)24-21(25)20-17(10-11-23-20)14-6-4-3-5-7-14/h8-9,12-14,17,20,23H,2-7,10-11H2,1H3,(H,24,25)/t17?,20-/m0/s1 |
| InChIKey | QEWKUDSIIWCZPF-OZBJMMHXSA-N |
| XLogP | 4.11 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |