C18H23FN2O3 — CID 118101089
4-[[(2S,3S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-2-fluorobenzoic acid (PubChem CID 118101089) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is 4-[[(2S,3S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-2-fluorobenzoic acid.
| Compound Name | 4-[[(2S,3S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 118101089 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 4-[[(2S,3S)-3-cyclohexylpyrrolidine-2-carbonyl]amino]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)[C@H]2NCC[C@H]2C2CCCCC2)cc1F |
| InChI | InChI=1S/C18H23FN2O3/c19-15-10-12(6-7-14(15)18(23)24)21-17(22)16-13(8-9-20-16)11-4-2-1-3-5-11/h6-7,10-11,13,16,20H,1-5,8-9H2,(H,21,22)(H,23,24)/t13-,16-/m0/s1 |
| InChIKey | JHJULMRGFSFUSO-BBRMVZONSA-N |
| XLogP | 3.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |