C20H28N4O3 — CID 21105278
ethyl 5-[(4-amino-1-ethylpiperidine-4-carbonyl)amino]-1-methylindole-2-carboxylate (PubChem CID 21105278) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is ethyl 5-[(4-amino-1-ethylpiperidine-4-carbonyl)amino]-1-methylindole-2-carboxylate.
| Compound Name | ethyl 5-[(4-amino-1-ethylpiperidine-4-carbonyl)amino]-1-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 21105278 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | ethyl 5-[(4-amino-1-ethylpiperidine-4-carbonyl)amino]-1-methylindole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(NC(=O)C3(N)CCN(CC)CC3)ccc2n1C |
| InChI | InChI=1S/C20H28N4O3/c1-4-24-10-8-20(21,9-11-24)19(26)22-15-6-7-16-14(12-15)13-17(23(16)3)18(25)27-5-2/h6-7,12-13H,4-5,8-11,21H2,1-3H3,(H,22,26) |
| InChIKey | QZDJOQNLQKBYAN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |