C16H20Cl2N2O2 — CID 10688716
ethyl 5-[bis(2-chloroethyl)amino]-1-methylindole-2-carboxylate (PubChem CID 10688716) has the molecular formula C16H20Cl2N2O2 and a molecular weight of 343.25 g/mol. Its IUPAC name is ethyl 5-[bis(2-chloroethyl)amino]-1-methylindole-2-carboxylate.
| Compound Name | ethyl 5-[bis(2-chloroethyl)amino]-1-methylindole-2-carboxylate |
|---|---|
| PubChem CID | 10688716 |
| Molecular Formula | C16H20Cl2N2O2 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | ethyl 5-[bis(2-chloroethyl)amino]-1-methylindole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(N(CCCl)CCCl)ccc2n1C |
| InChI | InChI=1S/C16H20Cl2N2O2/c1-3-22-16(21)15-11-12-10-13(4-5-14(12)19(15)2)20(8-6-17)9-7-18/h4-5,10-11H,3,6-9H2,1-2H3 |
| InChIKey | QMBVMOCRSUFGFA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|