C25H34N2O3 — CID 144816907
tert-butyl 4-[(3-phenylpiperidine-2-carbonyl)amino]benzoate;ethane (PubChem CID 144816907) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is tert-butyl 4-[(3-phenylpiperidine-2-carbonyl)amino]benzoate;ethane.
| Compound Name | tert-butyl 4-[(3-phenylpiperidine-2-carbonyl)amino]benzoate;ethane |
|---|---|
| PubChem CID | 144816907 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | tert-butyl 4-[(3-phenylpiperidine-2-carbonyl)amino]benzoate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)c1ccc(NC(=O)C2NCCCC2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N2O3.C2H6/c1-23(2,3)28-22(27)17-11-13-18(14-12-17)25-21(26)20-19(10-7-15-24-20)16-8-5-4-6-9-16;1-2/h4-6,8-9,11-14,19-20,24H,7,10,15H2,1-3H3,(H,25,26);1-2H3 |
| InChIKey | CJHDJTNKQULDLJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |