C14H19NO — CID 59054861
2-methyl-1-[(2S,3R)-3-phenylpyrrolidin-2-yl]propan-1-one (PubChem CID 59054861) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-methyl-1-[(2S,3R)-3-phenylpyrrolidin-2-yl]propan-1-one.
| Compound Name | 2-methyl-1-[(2S,3R)-3-phenylpyrrolidin-2-yl]propan-1-one |
|---|---|
| PubChem CID | 59054861 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-methyl-1-[(2S,3R)-3-phenylpyrrolidin-2-yl]propan-1-one |
| SMILES | CC(C)C(=O)[C@H]1NCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H19NO/c1-10(2)14(16)13-12(8-9-15-13)11-6-4-3-5-7-11/h3-7,10,12-13,15H,8-9H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | SCJTUOMEDNBFMG-OLZOCXBDSA-N |
| XLogP | 2.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |