C15H20N2O5 — CID 110696737
N-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxomorpholine-3-carboxamide (PubChem CID 110696737) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxomorpholine-3-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 110696737 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-oxomorpholine-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2COCC(=O)N2)cc1OC |
| InChI | InChI=1S/C15H20N2O5/c1-20-12-4-3-10(7-13(12)21-2)5-6-16-15(19)11-8-22-9-14(18)17-11/h3-4,7,11H,5-6,8-9H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | FOBQQPDCYCMKNR-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |