C18H22F2N4O3 — CID 162601924
N-[2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]ethyl]-2-(1H-imidazol-5-yl)acetamide (PubChem CID 162601924) has the molecular formula C18H22F2N4O3 and a molecular weight of 380.40 g/mol. Its IUPAC name is N-[2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]ethyl]-2-(1H-imidazol-5-yl)acetamide.
| Compound Name | N-[2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]ethyl]-2-(1H-imidazol-5-yl)acetamide |
|---|---|
| PubChem CID | 162601924 |
| Molecular Formula | C18H22F2N4O3 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]ethyl]-2-(1H-imidazol-5-yl)acetamide |
| SMILES | O=C(Cc1cnc[nH]1)NCCNc1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C18H22F2N4O3/c19-18(20)27-15-4-3-13(7-16(15)26-10-12-1-2-12)22-5-6-23-17(25)8-14-9-21-11-24-14/h3-4,7,9,11-12,18,22H,1-2,5-6,8,10H2,(H,21,24)(H,23,25) |
| InChIKey | YALKWSNWTCLVNU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|