C17H22F2N2O4 — CID 175911274
methyl (2S,4S)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]pyrrolidine-2-carboxylate (PubChem CID 175911274) has the molecular formula C17H22F2N2O4 and a molecular weight of 356.37 g/mol. Its IUPAC name is methyl (2S,4S)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 175911274 |
| Molecular Formula | C17H22F2N2O4 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | methyl (2S,4S)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](Nc2ccc(OC(F)F)c(OCC3CC3)c2)CN1 |
| InChI | InChI=1S/C17H22F2N2O4/c1-23-16(22)13-6-12(8-20-13)21-11-4-5-14(25-17(18)19)15(7-11)24-9-10-2-3-10/h4-5,7,10,12-13,17,20-21H,2-3,6,8-9H2,1H3/t12-,13-/m0/s1 |
| InChIKey | XIEIFUDGHGDRFC-STQMWFEESA-N |
| XLogP | 2.39 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|