C21H30F2N2O5 — CID 175911315
tert-butyl (2R,4S)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]-2-(hydroxymethyl)pyrrolidine-1-carboxylate (PubChem CID 175911315) has the molecular formula C21H30F2N2O5 and a molecular weight of 428.48 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]-2-(hydroxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175911315 |
| Molecular Formula | C21H30F2N2O5 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | tert-butyl (2R,4S)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)anilino]-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](Nc2ccc(OC(F)F)c(OCC3CC3)c2)C[C@@H]1CO |
| InChI | InChI=1S/C21H30F2N2O5/c1-21(2,3)30-20(27)25-10-15(8-16(25)11-26)24-14-6-7-17(29-19(22)23)18(9-14)28-12-13-4-5-13/h6-7,9,13,15-16,19,24,26H,4-5,8,10-12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | JUSLDRHJTOMVDG-JKSUJKDBSA-N |
| XLogP | 3.86 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|