C21H28F2N4O5 — CID 175911299
tert-butyl (2R,4S)-2-(azidomethyl)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenoxy]pyrrolidine-1-carboxylate (PubChem CID 175911299) has the molecular formula C21H28F2N4O5 and a molecular weight of 454.47 g/mol. Its IUPAC name is tert-butyl (2R,4S)-2-(azidomethyl)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4S)-2-(azidomethyl)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175911299 |
| Molecular Formula | C21H28F2N4O5 |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | tert-butyl (2R,4S)-2-(azidomethyl)-4-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenoxy]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](Oc2ccc(OC(F)F)c(OCC3CC3)c2)C[C@@H]1CN=[N+]=[N-] |
| InChI | InChI=1S/C21H28F2N4O5/c1-21(2,3)32-20(28)27-11-16(8-14(27)10-25-26-24)30-15-6-7-17(31-19(22)23)18(9-15)29-12-13-4-5-13/h6-7,9,13-14,16,19H,4-5,8,10-12H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | AUHCQNMRPMNMCM-ZBFHGGJFSA-N |
| XLogP | 5.14 |
| TPSA | 105.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|