C17H24N6O3 — CID 89466024
tert-butyl 2-(azidomethyl)-4-(5-cyclopropylpyrazin-2-yl)oxypyrrolidine-1-carboxylate (PubChem CID 89466024) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is tert-butyl 2-(azidomethyl)-4-(5-cyclopropylpyrazin-2-yl)oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(azidomethyl)-4-(5-cyclopropylpyrazin-2-yl)oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 89466024 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | tert-butyl 2-(azidomethyl)-4-(5-cyclopropylpyrazin-2-yl)oxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2cnc(C3CC3)cn2)CC1CN=[N+]=[N-] |
| InChI | InChI=1S/C17H24N6O3/c1-17(2,3)26-16(24)23-10-13(6-12(23)7-21-22-18)25-15-9-19-14(8-20-15)11-4-5-11/h8-9,11-13H,4-7,10H2,1-3H3 |
| InChIKey | MLBVKONYJYUUMR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 113.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|