C17H24N2O4 — CID 156738685
tert-butyl (2R,4R)-2-ethenyl-4-[(6-methoxy-3-pyridinyl)oxy]pyrrolidine-1-carboxylate (PubChem CID 156738685) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-ethenyl-4-[(6-methoxy-3-pyridinyl)oxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-ethenyl-4-[(6-methoxy-3-pyridinyl)oxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156738685 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | tert-butyl (2R,4R)-2-ethenyl-4-[(6-methoxy-3-pyridinyl)oxy]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@H]1C[C@@H](Oc2ccc(OC)nc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24N2O4/c1-6-12-9-14(11-19(12)16(20)23-17(2,3)4)22-13-7-8-15(21-5)18-10-13/h6-8,10,12,14H,1,9,11H2,2-5H3/t12-,14+/m0/s1 |
| InChIKey | JGUABUHUSRGWCO-GXTWGEPZSA-N |
| XLogP | 3.03 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|