C13H14F2O3 — CID 19705417
3-(cyclobutylmethoxy)-4-(difluoromethoxy)benzaldehyde (PubChem CID 19705417) has the molecular formula C13H14F2O3 and a molecular weight of 256.25 g/mol. Its IUPAC name is 3-(cyclobutylmethoxy)-4-(difluoromethoxy)benzaldehyde.
| Compound Name | 3-(cyclobutylmethoxy)-4-(difluoromethoxy)benzaldehyde |
|---|---|
| PubChem CID | 19705417 |
| Molecular Formula | C13H14F2O3 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 3-(cyclobutylmethoxy)-4-(difluoromethoxy)benzaldehyde |
| SMILES | O=Cc1ccc(OC(F)F)c(OCC2CCC2)c1 |
| InChI | InChI=1S/C13H14F2O3/c14-13(15)18-11-5-4-10(7-16)6-12(11)17-8-9-2-1-3-9/h4-7,9,13H,1-3,8H2 |
| InChIKey | XQNXIUNBRPORON-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|