C17H22F2O3 — CID 68754552
1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]cyclohexan-1-ol (PubChem CID 68754552) has the molecular formula C17H22F2O3 and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]cyclohexan-1-ol.
| Compound Name | 1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 68754552 |
| Molecular Formula | C17H22F2O3 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]cyclohexan-1-ol |
| SMILES | OC1(c2ccc(OC(F)F)c(OCC3CC3)c2)CCCCC1 |
| InChI | InChI=1S/C17H22F2O3/c18-16(19)22-14-7-6-13(17(20)8-2-1-3-9-17)10-15(14)21-11-12-4-5-12/h6-7,10,12,16,20H,1-5,8-9,11H2 |
| InChIKey | XSBBHDQYIPOBOC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |