C17H24F2O2 — CID 174834345
2-(cyclopropylmethoxy)-1-(difluoromethoxy)-4-hexan-3-ylbenzene (PubChem CID 174834345) has the molecular formula C17H24F2O2 and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-(cyclopropylmethoxy)-1-(difluoromethoxy)-4-hexan-3-ylbenzene.
| Compound Name | 2-(cyclopropylmethoxy)-1-(difluoromethoxy)-4-hexan-3-ylbenzene |
|---|---|
| PubChem CID | 174834345 |
| Molecular Formula | C17H24F2O2 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-(cyclopropylmethoxy)-1-(difluoromethoxy)-4-hexan-3-ylbenzene |
| SMILES | CCCC(CC)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C17H24F2O2/c1-3-5-13(4-2)14-8-9-15(21-17(18)19)16(10-14)20-11-12-6-7-12/h8-10,12-13,17H,3-7,11H2,1-2H3 |
| InChIKey | HAFNOCWNXQTQID-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |